C21H14Cl2N6O13S4 — CID 159938851
4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-hydroxy-6-[[4-(2-sulfoperoxyethynylsulfanyl)phenyl]diazenyl]-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid;hydrate (PubChem CID 159938851) has the molecular formula C21H14Cl2N6O13S4 and a molecular weight of 757.55 g/mol. Its IUPAC name is 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-hydroxy-6-[[4-(2-sulfoperoxyethynylsulfanyl)phenyl]diazenyl]-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid;hydrate.
| Compound Name | 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-hydroxy-6-[[4-(2-sulfoperoxyethynylsulfanyl)phenyl]diazenyl]-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid;hydrate |
|---|---|
| PubChem CID | 159938851 |
| Molecular Formula | C21H14Cl2N6O13S4 |
| Molecular Weight | 757.55 g/mol |
| Exact Mass | 755.89 |
| IUPAC Name | 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-hydroxy-6-[[4-(2-sulfoperoxyethynylsulfanyl)phenyl]diazenyl]-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid;hydrate |
| SMILES | O.O=S(=O)(O)OOC#CSc1ccc(/N=N/c2c(SOOO)cc3cc(S(=O)(=O)O)cc(Nc4nc(Cl)nc(Cl)n4)c3c2O)cc1 |
| InChI | InChI=1S/C21H12Cl2N6O12S4.H2O/c22-19-25-20(23)27-21(26-19)24-14-9-13(44(32,33)34)7-10-8-15(43-40-39-31)17(18(30)16(10)14)29-28-11-1-3-12(4-2-11)42-6-5-38-41-45(35,36)37;/h1-4,7-9,30-31H,(H,32,33,34)(H,35,36,37)(H,24,25,26,27);1H2/b29-28+; |
| InChIKey | ANTSIMQEQYJCMD-IRWWKPKRSA-N |
| XLogP | 4.81 |
| TPSA | 293.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|