C13H15NO4S — CID 21022867
5-methoxy-N,6-dimethyl-7-(trioxidanylsulfanyl)naphthalen-2-amine (PubChem CID 21022867) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is 5-methoxy-N,6-dimethyl-7-(trioxidanylsulfanyl)naphthalen-2-amine.
| Compound Name | 5-methoxy-N,6-dimethyl-7-(trioxidanylsulfanyl)naphthalen-2-amine |
|---|---|
| PubChem CID | 21022867 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 5-methoxy-N,6-dimethyl-7-(trioxidanylsulfanyl)naphthalen-2-amine |
| SMILES | CNc1ccc2c(OC)c(C)c(SOOO)cc2c1 |
| InChI | InChI=1S/C13H15NO4S/c1-8-12(19-18-17-15)7-9-6-10(14-2)4-5-11(9)13(8)16-3/h4-7,14-15H,1-3H3 |
| InChIKey | HMGXQXZZEDVZSD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|