C13H17NO7S2 — CID 159227262
4-amino-5-methoxy-6-methyl-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid;methane (PubChem CID 159227262) has the molecular formula C13H17NO7S2 and a molecular weight of 363.41 g/mol. Its IUPAC name is 4-amino-5-methoxy-6-methyl-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid;methane.
| Compound Name | 4-amino-5-methoxy-6-methyl-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid;methane |
|---|---|
| PubChem CID | 159227262 |
| Molecular Formula | C13H17NO7S2 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 4-amino-5-methoxy-6-methyl-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid;methane |
| SMILES | C.COc1c(C)c(SOOO)cc2cc(S(=O)(=O)O)cc(N)c12 |
| InChI | InChI=1S/C12H13NO7S2.CH4/c1-6-10(21-20-19-14)4-7-3-8(22(15,16)17)5-9(13)11(7)12(6)18-2;/h3-5,14H,13H2,1-2H3,(H,15,16,17);1H4 |
| InChIKey | KSLFXKHQJMVHIP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|