C21H17N3O5S — CID 59334193
1-amino-4-[4-(methylamino)anilino]-2-(trioxidanylsulfanyl)anthracene-9,10-dione (PubChem CID 59334193) has the molecular formula C21H17N3O5S and a molecular weight of 423.45 g/mol. Its IUPAC name is 1-amino-4-[4-(methylamino)anilino]-2-(trioxidanylsulfanyl)anthracene-9,10-dione.
| Compound Name | 1-amino-4-[4-(methylamino)anilino]-2-(trioxidanylsulfanyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 59334193 |
| Molecular Formula | C21H17N3O5S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 1-amino-4-[4-(methylamino)anilino]-2-(trioxidanylsulfanyl)anthracene-9,10-dione |
| SMILES | CNc1ccc(Nc2cc(SOOO)c(N)c3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C21H17N3O5S/c1-23-11-6-8-12(9-7-11)24-15-10-16(30-29-28-27)19(22)18-17(15)20(25)13-4-2-3-5-14(13)21(18)26/h2-10,23-24,27H,22H2,1H3 |
| InChIKey | KPRTYMYWIMWIMZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|