C28H19BrN2O5 — CID 21195063
methyl 4-[4-[(4-amino-3-bromo-9,10-dioxoanthracen-1-yl)amino]phenoxy]benzoate (PubChem CID 21195063) has the molecular formula C28H19BrN2O5 and a molecular weight of 543.37 g/mol. Its IUPAC name is methyl 4-[4-[(4-amino-3-bromo-9,10-dioxoanthracen-1-yl)amino]phenoxy]benzoate.
| Compound Name | methyl 4-[4-[(4-amino-3-bromo-9,10-dioxoanthracen-1-yl)amino]phenoxy]benzoate |
|---|---|
| PubChem CID | 21195063 |
| Molecular Formula | C28H19BrN2O5 |
| Molecular Weight | 543.37 g/mol |
| Exact Mass | 542.05 |
| IUPAC Name | methyl 4-[4-[(4-amino-3-bromo-9,10-dioxoanthracen-1-yl)amino]phenoxy]benzoate |
| SMILES | COC(=O)c1ccc(Oc2ccc(Nc3cc(Br)c(N)c4c3C(=O)c3ccccc3C4=O)cc2)cc1 |
| InChI | InChI=1S/C28H19BrN2O5/c1-35-28(34)15-6-10-17(11-7-15)36-18-12-8-16(9-13-18)31-22-14-21(29)25(30)24-23(22)26(32)19-4-2-3-5-20(19)27(24)33/h2-14,31H,30H2,1H3 |
| InChIKey | WCROHCZPRZCJIX-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.37 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|