C21H11BrCl2N2O3 — CID 23454436
N-(4-amino-3-bromo-9,10-dioxoanthracen-1-yl)-3,5-dichlorobenzamide (PubChem CID 23454436) has the molecular formula C21H11BrCl2N2O3 and a molecular weight of 490.14 g/mol. Its IUPAC name is N-(4-amino-3-bromo-9,10-dioxoanthracen-1-yl)-3,5-dichlorobenzamide.
| Compound Name | N-(4-amino-3-bromo-9,10-dioxoanthracen-1-yl)-3,5-dichlorobenzamide |
|---|---|
| PubChem CID | 23454436 |
| Molecular Formula | C21H11BrCl2N2O3 |
| Molecular Weight | 490.14 g/mol |
| Exact Mass | 487.93 |
| IUPAC Name | N-(4-amino-3-bromo-9,10-dioxoanthracen-1-yl)-3,5-dichlorobenzamide |
| SMILES | Nc1c(Br)cc(NC(=O)c2cc(Cl)cc(Cl)c2)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H11BrCl2N2O3/c22-14-8-15(26-21(29)9-5-10(23)7-11(24)6-9)16-17(18(14)25)20(28)13-4-2-1-3-12(13)19(16)27/h1-8H,25H2,(H,26,29) |
| InChIKey | MMLODIMSEXDYQD-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.14 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|