C21H12Cl2N2O3 — CID 163650407
N-(4-amino-6-chloro-9,10-dioxoanthracen-1-yl)-4-chlorobenzamide (PubChem CID 163650407) has the molecular formula C21H12Cl2N2O3 and a molecular weight of 411.24 g/mol. Its IUPAC name is N-(4-amino-6-chloro-9,10-dioxoanthracen-1-yl)-4-chlorobenzamide.
| Compound Name | N-(4-amino-6-chloro-9,10-dioxoanthracen-1-yl)-4-chlorobenzamide |
|---|---|
| PubChem CID | 163650407 |
| Molecular Formula | C21H12Cl2N2O3 |
| Molecular Weight | 411.24 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | N-(4-amino-6-chloro-9,10-dioxoanthracen-1-yl)-4-chlorobenzamide |
| SMILES | Nc1ccc(NC(=O)c2ccc(Cl)cc2)c2c1C(=O)c1cc(Cl)ccc1C2=O |
| InChI | InChI=1S/C21H12Cl2N2O3/c22-11-3-1-10(2-4-11)21(28)25-16-8-7-15(24)17-18(16)19(26)13-6-5-12(23)9-14(13)20(17)27/h1-9H,24H2,(H,25,28) |
| InChIKey | ILTXWEVLFUQGDS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.24 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|