C17H14N2O4 — CID 3019962
N-(4-amino-3-methoxy-9,10-dioxoanthracen-1-yl)acetamide (PubChem CID 3019962) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is N-(4-amino-3-methoxy-9,10-dioxoanthracen-1-yl)acetamide.
| Compound Name | N-(4-amino-3-methoxy-9,10-dioxoanthracen-1-yl)acetamide |
|---|---|
| PubChem CID | 3019962 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-(4-amino-3-methoxy-9,10-dioxoanthracen-1-yl)acetamide |
| SMILES | COc1cc(NC(C)=O)c2c(c1N)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H14N2O4/c1-8(20)19-11-7-12(23-2)15(18)14-13(11)16(21)9-5-3-4-6-10(9)17(14)22/h3-7H,18H2,1-2H3,(H,19,20) |
| InChIKey | SVFPILGVWYPIDO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|