C26H26N3O5+ — CID 158871904
2-[2-[(4-amino-3-methoxy-9,10-dioxoanthracen-1-yl)amino]benzoyl]oxyethyl-dimethylazanium (PubChem CID 158871904) has the molecular formula C26H26N3O5+ and a molecular weight of 460.51 g/mol. Its IUPAC name is 2-[2-[(4-amino-3-methoxy-9,10-dioxoanthracen-1-yl)amino]benzoyl]oxyethyl-dimethylazanium.
| Compound Name | 2-[2-[(4-amino-3-methoxy-9,10-dioxoanthracen-1-yl)amino]benzoyl]oxyethyl-dimethylazanium |
|---|---|
| PubChem CID | 158871904 |
| Molecular Formula | C26H26N3O5+ |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 2-[2-[(4-amino-3-methoxy-9,10-dioxoanthracen-1-yl)amino]benzoyl]oxyethyl-dimethylazanium |
| SMILES | COc1cc(Nc2ccccc2C(=O)OCC[NH+](C)C)c2c(c1N)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C26H25N3O5/c1-29(2)12-13-34-26(32)17-10-6-7-11-18(17)28-19-14-20(33-3)23(27)22-21(19)24(30)15-8-4-5-9-16(15)25(22)31/h4-11,14,28H,12-13,27H2,1-3H3/p+1 |
| InChIKey | JBYJERDWEPMHID-UHFFFAOYSA-O |
| XLogP | 2.10 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|