About 2-[(4-amino-9,10-dioxo-3-sulfanylanthracen-1-yl)amino]-5-chlorobenzoic acid
2-[(4-amino-9,10-dioxo-3-sulfanylanthracen-1-yl)amino]-5-chlorobenzoic acid (PubChem CID 145469104) has the molecular formula C21H13ClN2O4S
and a molecular weight of 424.87 g/mol. Its IUPAC name is 2-[(4-amino-9,10-dioxo-3-sulfanylanthracen-1-yl)amino]-5-chlorobenzoic acid.
Molecular Properties
| Compound Name | 2-[(4-amino-9,10-dioxo-3-sulfanylanthracen-1-yl)amino]-5-chlorobenzoic acid |
| PubChem CID | 145469104 |
| Molecular Formula | C21H13ClN2O4S |
| Molecular Weight | 424.87 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | 2-[(4-amino-9,10-dioxo-3-sulfanylanthracen-1-yl)amino]-5-chlorobenzoic acid |
| SMILES | Nc1c(S)cc(Nc2ccc(Cl)cc2C(=O)O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H13ClN2O4S/c22-9-5-6-13(12(7-9)21(27)28)24-14-8-15(29)18(23)17-16(14)19(25)10-3-1-2-4-11(10)20(17)26/h1-8,24,29H,23H2,(H,27,28) |
| InChIKey | DWZGYFJIDCUAQO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.87 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-amino-9,10-dioxo-3-sulfanylanthracen-1-yl)amino]-5-chlorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-amino-9,10-dioxo-3-sulfanylanthracen-1-yl)amino]-5-chlorobenzoic acid?
The IUPAC name of 2-[(4-amino-9,10-dioxo-3-sulfanylanthracen-1-yl)amino]-5-chlorobenzoic acid (CID 145469104) is 2-[(4-amino-9,10-dioxo-3-sulfanylanthracen-1-yl)amino]-5-chlorobenzoic acid.
What is the SMILES notation for 2-[(4-amino-9,10-dioxo-3-sulfanylanthracen-1-yl)amino]-5-chlorobenzoic acid?
The canonical SMILES for 2-[(4-amino-9,10-dioxo-3-sulfanylanthracen-1-yl)amino]-5-chlorobenzoic acid is Nc1c(S)cc(Nc2ccc(Cl)cc2C(=O)O)c2c1C(=O)c1ccccc1C2=O.
What is the InChIKey of 2-[(4-amino-9,10-dioxo-3-sulfanylanthracen-1-yl)amino]-5-chlorobenzoic acid?
The InChIKey is DWZGYFJIDCUAQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13ClN2O4S/c22-9-5-6-13(12(7-9)21(27)28)24-14-8-15(29)18(23)17-16(14)19(25)10-3-1-2-4-11(10)20(17)26/h1-8,24,29H,23H2,(H,27,28).
What are the key properties of 2-[(4-amino-9,10-dioxo-3-sulfanylanthracen-1-yl)amino]-5-chlorobenzoic acid?
2-[(4-amino-9,10-dioxo-3-sulfanylanthracen-1-yl)amino]-5-chlorobenzoic acid has a molecular weight of 424.87 g/mol, XLogP of 4.43, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-amino-9,10-dioxo-3-sulfanylanthracen-1-yl)amino]-5-chlorobenzoic acid is sourced from PubChem (CID 145469104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).