C18H13N3O5 — CID 89029353
N-(4-amino-3-nitro-9,10-dioxoanthracen-1-yl)-2-methylprop-2-enamide (PubChem CID 89029353) has the molecular formula C18H13N3O5 and a molecular weight of 351.32 g/mol. Its IUPAC name is N-(4-amino-3-nitro-9,10-dioxoanthracen-1-yl)-2-methylprop-2-enamide.
| Compound Name | N-(4-amino-3-nitro-9,10-dioxoanthracen-1-yl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 89029353 |
| Molecular Formula | C18H13N3O5 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | N-(4-amino-3-nitro-9,10-dioxoanthracen-1-yl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1cc([N+](=O)[O-])c(N)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H13N3O5/c1-8(2)18(24)20-11-7-12(21(25)26)15(19)14-13(11)16(22)9-5-3-4-6-10(9)17(14)23/h3-7H,1,19H2,2H3,(H,20,24) |
| InChIKey | LYPAKFNJSBACOY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|