C24H15N3O7 — CID 2750711
N-[2-[2-(2,4-dinitrophenyl)ethenyl]-9,10-dioxoanthracen-1-yl]acetamide (PubChem CID 2750711) has the molecular formula C24H15N3O7 and a molecular weight of 457.40 g/mol. Its IUPAC name is N-[2-[2-(2,4-dinitrophenyl)ethenyl]-9,10-dioxoanthracen-1-yl]acetamide.
| Compound Name | N-[2-[2-(2,4-dinitrophenyl)ethenyl]-9,10-dioxoanthracen-1-yl]acetamide |
|---|---|
| PubChem CID | 2750711 |
| Molecular Formula | C24H15N3O7 |
| Molecular Weight | 457.40 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | N-[2-[2-(2,4-dinitrophenyl)ethenyl]-9,10-dioxoanthracen-1-yl]acetamide |
| SMILES | CC(=O)Nc1c(C=Cc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])ccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H15N3O7/c1-13(28)25-22-15(7-6-14-8-10-16(26(31)32)12-20(14)27(33)34)9-11-19-21(22)24(30)18-5-3-2-4-17(18)23(19)29/h2-12H,1H3,(H,25,28) |
| InChIKey | JCBYQUKWBVNXJH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 149.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|