C17H11NO4 — CID 2749308
N-(2-formyl-9,10-dioxoanthracen-1-yl)acetamide (PubChem CID 2749308) has the molecular formula C17H11NO4 and a molecular weight of 293.28 g/mol. Its IUPAC name is N-(2-formyl-9,10-dioxoanthracen-1-yl)acetamide.
| Compound Name | N-(2-formyl-9,10-dioxoanthracen-1-yl)acetamide |
|---|---|
| PubChem CID | 2749308 |
| Molecular Formula | C17H11NO4 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | N-(2-formyl-9,10-dioxoanthracen-1-yl)acetamide |
| SMILES | CC(=O)Nc1c(C=O)ccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H11NO4/c1-9(20)18-15-10(8-19)6-7-13-14(15)17(22)12-5-3-2-4-11(12)16(13)21/h2-8H,1H3,(H,18,20) |
| InChIKey | DFOZJHBWZHQKAM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|