C15H10BrNO2 — CID 19897935
2-bromo-1-(methylamino)anthracene-9,10-dione (PubChem CID 19897935) has the molecular formula C15H10BrNO2 and a molecular weight of 316.15 g/mol. Its IUPAC name is 2-bromo-1-(methylamino)anthracene-9,10-dione.
| Compound Name | 2-bromo-1-(methylamino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 19897935 |
| Molecular Formula | C15H10BrNO2 |
| Molecular Weight | 316.15 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 2-bromo-1-(methylamino)anthracene-9,10-dione |
| SMILES | CNc1c(Br)ccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C15H10BrNO2/c1-17-13-11(16)7-6-10-12(13)15(19)9-5-3-2-4-8(9)14(10)18/h2-7,17H,1H3 |
| InChIKey | XPZRLOAGIQPVBC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.15 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|