C17H8Br2O — CID 172800935
3,6-dibromobenzo[a]phenalen-7-one (PubChem CID 172800935) has the molecular formula C17H8Br2O and a molecular weight of 388.06 g/mol. Its IUPAC name is 3,6-dibromobenzo[a]phenalen-7-one.
| Compound Name | 3,6-dibromobenzo[a]phenalen-7-one |
|---|---|
| PubChem CID | 172800935 |
| Molecular Formula | C17H8Br2O |
| Molecular Weight | 388.06 g/mol |
| Exact Mass | 385.89 |
| IUPAC Name | 3,6-dibromobenzo[a]phenalen-7-one |
| SMILES | O=C1c2ccccc2-c2ccc(Br)c3ccc(Br)c1c23 |
| InChI | InChI=1S/C17H8Br2O/c18-13-7-5-10-9-3-1-2-4-11(9)17(20)16-14(19)8-6-12(13)15(10)16/h1-8H |
| InChIKey | QVUMDBZBMUBYIX-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.06 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |