About 3-bromofluoranthene;8-bromofluoranthene
3-bromofluoranthene;8-bromofluoranthene (PubChem CID 174507222) has the molecular formula C32H18Br2
and a molecular weight of 562.30 g/mol. Its IUPAC name is 3-bromofluoranthene;8-bromofluoranthene.
Molecular Properties
| Compound Name | 3-bromofluoranthene;8-bromofluoranthene |
| PubChem CID | 174507222 |
| Molecular Formula | C32H18Br2 |
| Molecular Weight | 562.30 g/mol |
| Exact Mass | 559.98 |
| IUPAC Name | 3-bromofluoranthene;8-bromofluoranthene |
| SMILES | Brc1ccc2c(c1)-c1cccc3cccc-2c13.Brc1ccc2c3c(cccc13)-c1ccccc1-2 |
| InChI | InChI=1S/2C16H9Br/c17-11-7-8-12-13-5-1-3-10-4-2-6-14(16(10)13)15(12)9-11;17-15-9-8-13-11-5-2-1-4-10(11)12-6-3-7-14(15)16(12)13/h2*1-9H |
| InChIKey | MJJOIYHFKYWIIO-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 562.30 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-bromofluoranthene;8-bromofluoranthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromofluoranthene;8-bromofluoranthene?
The IUPAC name of 3-bromofluoranthene;8-bromofluoranthene (CID 174507222) is 3-bromofluoranthene;8-bromofluoranthene.
What is the SMILES notation for 3-bromofluoranthene;8-bromofluoranthene?
The canonical SMILES for 3-bromofluoranthene;8-bromofluoranthene is Brc1ccc2c(c1)-c1cccc3cccc-2c13.Brc1ccc2c3c(cccc13)-c1ccccc1-2.
What is the InChIKey of 3-bromofluoranthene;8-bromofluoranthene?
The InChIKey is MJJOIYHFKYWIIO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C16H9Br/c17-11-7-8-12-13-5-1-3-10-4-2-6-14(16(10)13)15(12)9-11;17-15-9-8-13-11-5-2-1-4-10(11)12-6-3-7-14(15)16(12)13/h2*1-9H.
What are the key properties of 3-bromofluoranthene;8-bromofluoranthene?
3-bromofluoranthene;8-bromofluoranthene has a molecular weight of 562.30 g/mol, XLogP of 10.50, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromofluoranthene;8-bromofluoranthene is sourced from PubChem (CID 174507222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).