C18H10F7NO2 — CID 15194746
2-(1,1,2,2,3,3,3-heptafluoropropyl)-1-(methylamino)anthracene-9,10-dione (PubChem CID 15194746) has the molecular formula C18H10F7NO2 and a molecular weight of 405.27 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropyl)-1-(methylamino)anthracene-9,10-dione.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-1-(methylamino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 15194746 |
| Molecular Formula | C18H10F7NO2 |
| Molecular Weight | 405.27 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-1-(methylamino)anthracene-9,10-dione |
| SMILES | CNc1c(C(F)(F)C(F)(F)C(F)(F)F)ccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H10F7NO2/c1-26-13-11(16(19,20)17(21,22)18(23,24)25)7-6-10-12(13)15(28)9-5-3-2-4-8(9)14(10)27/h2-7,26H,1H3 |
| InChIKey | CZMMJUIUKPMQJS-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.27 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|