C22H11F14NO2 — CID 139617666
1-(dimethylamino)-2,4-bis(1,1,2,2,3,3,3-heptafluoropropyl)anthracene-9,10-dione (PubChem CID 139617666) has the molecular formula C22H11F14NO2 and a molecular weight of 587.31 g/mol. Its IUPAC name is 1-(dimethylamino)-2,4-bis(1,1,2,2,3,3,3-heptafluoropropyl)anthracene-9,10-dione.
| Compound Name | 1-(dimethylamino)-2,4-bis(1,1,2,2,3,3,3-heptafluoropropyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 139617666 |
| Molecular Formula | C22H11F14NO2 |
| Molecular Weight | 587.31 g/mol |
| Exact Mass | 587.06 |
| IUPAC Name | 1-(dimethylamino)-2,4-bis(1,1,2,2,3,3,3-heptafluoropropyl)anthracene-9,10-dione |
| SMILES | CN(C)c1c(C(F)(F)C(F)(F)C(F)(F)F)cc(C(F)(F)C(F)(F)C(F)(F)F)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H11F14NO2/c1-37(2)14-11(18(25,26)20(29,30)22(34,35)36)7-10(17(23,24)19(27,28)21(31,32)33)12-13(14)16(39)9-6-4-3-5-8(9)15(12)38/h3-7H,1-2H3 |
| InChIKey | JXGRSZCLTUUWPD-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.31 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|