C18H6F6O2S2 — CID 58659846
2-[5,6-bis(trifluoromethyl)-1,3-benzodithiol-2-ylidene]indene-1,3-dione (PubChem CID 58659846) has the molecular formula C18H6F6O2S2 and a molecular weight of 432.37 g/mol. Its IUPAC name is 2-[5,6-bis(trifluoromethyl)-1,3-benzodithiol-2-ylidene]indene-1,3-dione.
| Compound Name | 2-[5,6-bis(trifluoromethyl)-1,3-benzodithiol-2-ylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 58659846 |
| Molecular Formula | C18H6F6O2S2 |
| Molecular Weight | 432.37 g/mol |
| Exact Mass | 431.97 |
| IUPAC Name | 2-[5,6-bis(trifluoromethyl)-1,3-benzodithiol-2-ylidene]indene-1,3-dione |
| SMILES | O=C1C(=C2Sc3cc(C(F)(F)F)c(C(F)(F)F)cc3S2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C18H6F6O2S2/c19-17(20,21)9-5-11-12(6-10(9)18(22,23)24)28-16(27-11)13-14(25)7-3-1-2-4-8(7)15(13)26/h1-6H |
| InChIKey | FGVAZERWBISGMZ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.37 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|