C21H12ClF3O5S — CID 175116393
anthracene-9,10-dione;4-chloro-3-(trifluoromethyl)benzenesulfonic acid (PubChem CID 175116393) has the molecular formula C21H12ClF3O5S and a molecular weight of 468.84 g/mol. Its IUPAC name is anthracene-9,10-dione;4-chloro-3-(trifluoromethyl)benzenesulfonic acid.
| Compound Name | anthracene-9,10-dione;4-chloro-3-(trifluoromethyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 175116393 |
| Molecular Formula | C21H12ClF3O5S |
| Molecular Weight | 468.84 g/mol |
| Exact Mass | 468.00 |
| IUPAC Name | anthracene-9,10-dione;4-chloro-3-(trifluoromethyl)benzenesulfonic acid |
| SMILES | O=C1c2ccccc2C(=O)c2ccccc21.O=S(=O)(O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H8O2.C7H4ClF3O3S/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;8-6-2-1-4(15(12,13)14)3-5(6)7(9,10)11/h1-8H;1-3H,(H,12,13,14) |
| InChIKey | OIYNHGJGPWIGHT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.84 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|