C40H20S10 — CID 102260692
2-[2,3,4,5-tetrakis(1,3-benzodithiol-2-ylidene)cyclopentylidene]-1,3-benzodithiole (PubChem CID 102260692) has the molecular formula C40H20S10 and a molecular weight of 821.27 g/mol. Its IUPAC name is 2-[2,3,4,5-tetrakis(1,3-benzodithiol-2-ylidene)cyclopentylidene]-1,3-benzodithiole.
| Compound Name | 2-[2,3,4,5-tetrakis(1,3-benzodithiol-2-ylidene)cyclopentylidene]-1,3-benzodithiole |
|---|---|
| PubChem CID | 102260692 |
| Molecular Formula | C40H20S10 |
| Molecular Weight | 821.27 g/mol |
| Exact Mass | 819.88 |
| IUPAC Name | 2-[2,3,4,5-tetrakis(1,3-benzodithiol-2-ylidene)cyclopentylidene]-1,3-benzodithiole |
| SMILES | c1ccc2c(c1)SC(=C1C(=C3Sc4ccccc4S3)C(=C3Sc4ccccc4S3)C(=C3Sc4ccccc4S3)C1=C1Sc3ccccc3S1)S2 |
| InChI | InChI=1S/C40H20S10/c1-2-12-22-21(11-1)41-36(42-22)31-32(37-43-23-13-3-4-14-24(23)44-37)34(39-47-27-17-7-8-18-28(27)48-39)35(40-49-29-19-9-10-20-30(29)50-40)33(31)38-45-25-15-5-6-16-26(25)46-38/h1-20H |
| InChIKey | XOHSRLVCPIAAJF-UHFFFAOYSA-N |
| XLogP | 15.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.27 |
| LogP ≤ 5 | 15.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |