C26H21F3NO3- — CID 59587862
1-ethyl-4-[1-[2-[methyl(oxido)amino]-4-(trifluoromethyl)phenyl]ethyl]anthracene-9,10-dione (PubChem CID 59587862) has the molecular formula C26H21F3NO3- and a molecular weight of 452.45 g/mol. Its IUPAC name is 1-ethyl-4-[1-[2-[methyl(oxido)amino]-4-(trifluoromethyl)phenyl]ethyl]anthracene-9,10-dione.
| Compound Name | 1-ethyl-4-[1-[2-[methyl(oxido)amino]-4-(trifluoromethyl)phenyl]ethyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 59587862 |
| Molecular Formula | C26H21F3NO3- |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 1-ethyl-4-[1-[2-[methyl(oxido)amino]-4-(trifluoromethyl)phenyl]ethyl]anthracene-9,10-dione |
| SMILES | CCc1ccc(C(C)c2ccc(C(F)(F)F)cc2N(C)[O-])c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C26H21F3NO3/c1-4-15-9-11-18(23-22(15)24(31)19-7-5-6-8-20(19)25(23)32)14(2)17-12-10-16(26(27,28)29)13-21(17)30(3)33/h5-14H,4H2,1-3H3/q-1 |
| InChIKey | CECXPNMKLNZXRS-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|