C19H12F7NO2 — CID 15194752
1-(dimethylamino)-4-(1,1,2,2,3,3,3-heptafluoropropyl)anthracene-9,10-dione (PubChem CID 15194752) has the molecular formula C19H12F7NO2 and a molecular weight of 419.30 g/mol. Its IUPAC name is 1-(dimethylamino)-4-(1,1,2,2,3,3,3-heptafluoropropyl)anthracene-9,10-dione.
| Compound Name | 1-(dimethylamino)-4-(1,1,2,2,3,3,3-heptafluoropropyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 15194752 |
| Molecular Formula | C19H12F7NO2 |
| Molecular Weight | 419.30 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 1-(dimethylamino)-4-(1,1,2,2,3,3,3-heptafluoropropyl)anthracene-9,10-dione |
| SMILES | CN(C)c1ccc(C(F)(F)C(F)(F)C(F)(F)F)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H12F7NO2/c1-27(2)12-8-7-11(17(20,21)18(22,23)19(24,25)26)13-14(12)16(29)10-6-4-3-5-9(10)15(13)28/h3-8H,1-2H3 |
| InChIKey | NONCASXGNJKXCT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.30 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|