C20H25N3O — CID 142921768
10-(dimethylamino)-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one;ethane (PubChem CID 142921768) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 10-(dimethylamino)-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one;ethane.
| Compound Name | 10-(dimethylamino)-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one;ethane |
|---|---|
| PubChem CID | 142921768 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 10-(dimethylamino)-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one;ethane |
| SMILES | CC.CC.CN(C)c1ccc2[nH]nc3c2c1C(=O)c1ccccc1-3 |
| InChI | InChI=1S/C16H13N3O.2C2H6/c1-19(2)12-8-7-11-13-14(12)16(20)10-6-4-3-5-9(10)15(13)18-17-11;2*1-2/h3-8H,1-2H3,(H,17,18);2*1-2H3 |
| InChIKey | LJHMGFVEBQBGPW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |