C22H16N2O3 — CID 5166275
N-(4-anilino-9,10-dioxoanthracen-1-yl)acetamide (PubChem CID 5166275) has the molecular formula C22H16N2O3 and a molecular weight of 356.38 g/mol. Its IUPAC name is N-(4-anilino-9,10-dioxoanthracen-1-yl)acetamide.
| Compound Name | N-(4-anilino-9,10-dioxoanthracen-1-yl)acetamide |
|---|---|
| PubChem CID | 5166275 |
| Molecular Formula | C22H16N2O3 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | N-(4-anilino-9,10-dioxoanthracen-1-yl)acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2ccccc2)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H16N2O3/c1-13(25)23-17-11-12-18(24-14-7-3-2-4-8-14)20-19(17)21(26)15-9-5-6-10-16(15)22(20)27/h2-12,24H,1H3,(H,23,25) |
| InChIKey | NZNQCFRVZSFFAG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|