About anthracene-9,10-dione;bis(N-phenylaniline)
anthracene-9,10-dione;bis(N-phenylaniline) (PubChem CID 174974438) has the molecular formula C38H30N2O2
and a molecular weight of 546.67 g/mol. Its IUPAC name is anthracene-9,10-dione;bis(N-phenylaniline).
Molecular Properties
| Compound Name | anthracene-9,10-dione;bis(N-phenylaniline) |
| PubChem CID | 174974438 |
| Molecular Formula | C38H30N2O2 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | anthracene-9,10-dione;bis(N-phenylaniline) |
| SMILES | O=C1c2ccccc2C(=O)c2ccccc21.c1ccc(Nc2ccccc2)cc1.c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C14H8O2.2C12H11N/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;2*1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-8H;2*1-10,13H |
| InChIKey | VOIIIRCOGAAXNO-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze anthracene-9,10-dione;bis(N-phenylaniline) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene-9,10-dione;bis(N-phenylaniline)?
The IUPAC name of anthracene-9,10-dione;bis(N-phenylaniline) (CID 174974438) is anthracene-9,10-dione;bis(N-phenylaniline).
What is the SMILES notation for anthracene-9,10-dione;bis(N-phenylaniline)?
The canonical SMILES for anthracene-9,10-dione;bis(N-phenylaniline) is O=C1c2ccccc2C(=O)c2ccccc21.c1ccc(Nc2ccccc2)cc1.c1ccc(Nc2ccccc2)cc1.
What is the InChIKey of anthracene-9,10-dione;bis(N-phenylaniline)?
The InChIKey is VOIIIRCOGAAXNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8O2.2C12H11N/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;2*1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-8H;2*1-10,13H.
What are the key properties of anthracene-9,10-dione;bis(N-phenylaniline)?
anthracene-9,10-dione;bis(N-phenylaniline) has a molecular weight of 546.67 g/mol, XLogP of 9.32, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene-9,10-dione;bis(N-phenylaniline) is sourced from PubChem (CID 174974438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).