About anthracene-9,10-dione;N-phenylhydroxylamine
anthracene-9,10-dione;N-phenylhydroxylamine (PubChem CID 162241472) has the molecular formula C20H15NO3
and a molecular weight of 317.34 g/mol. Its IUPAC name is anthracene-9,10-dione;N-phenylhydroxylamine.
Molecular Properties
| Compound Name | anthracene-9,10-dione;N-phenylhydroxylamine |
| PubChem CID | 162241472 |
| Molecular Formula | C20H15NO3 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | anthracene-9,10-dione;N-phenylhydroxylamine |
| SMILES | O=C1c2ccccc2C(=O)c2ccccc21.ONc1ccccc1 |
| InChI | InChI=1S/C14H8O2.C6H7NO/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;8-7-6-4-2-1-3-5-6/h1-8H;1-5,7-8H |
| InChIKey | ZWTMAVVHFHTIHE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze anthracene-9,10-dione;N-phenylhydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene-9,10-dione;N-phenylhydroxylamine?
The IUPAC name of anthracene-9,10-dione;N-phenylhydroxylamine (CID 162241472) is anthracene-9,10-dione;N-phenylhydroxylamine.
What is the SMILES notation for anthracene-9,10-dione;N-phenylhydroxylamine?
The canonical SMILES for anthracene-9,10-dione;N-phenylhydroxylamine is O=C1c2ccccc2C(=O)c2ccccc21.ONc1ccccc1.
What is the InChIKey of anthracene-9,10-dione;N-phenylhydroxylamine?
The InChIKey is ZWTMAVVHFHTIHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8O2.C6H7NO/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;8-7-6-4-2-1-3-5-6/h1-8H;1-5,7-8H.
What are the key properties of anthracene-9,10-dione;N-phenylhydroxylamine?
anthracene-9,10-dione;N-phenylhydroxylamine has a molecular weight of 317.34 g/mol, XLogP of 3.95, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene-9,10-dione;N-phenylhydroxylamine is sourced from PubChem (CID 162241472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).