About dibismuth;N-phenylaniline;trisulfate
dibismuth;N-phenylaniline;trisulfate (PubChem CID 174856272) has the molecular formula C12H11Bi2NO12S3
and a molecular weight of 875.38 g/mol. Its IUPAC name is dibismuth;N-phenylaniline;trisulfate.
Molecular Properties
| Compound Name | dibismuth;N-phenylaniline;trisulfate |
| PubChem CID | 174856272 |
| Molecular Formula | C12H11Bi2NO12S3 |
| Molecular Weight | 875.38 g/mol |
| Exact Mass | 874.91 |
| IUPAC Name | dibismuth;N-phenylaniline;trisulfate |
| SMILES | O=S(=O)([O-])[O-].O=S(=O)([O-])[O-].O=S(=O)([O-])[O-].[Bi+3].[Bi+3].c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11N.2Bi.3H2O4S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;;3*1-5(2,3)4/h1-10,13H;;;3*(H2,1,2,3,4)/q;2*+3;;;/p-6 |
| InChIKey | NMDILZOGCFABKO-UHFFFAOYSA-H |
| XLogP | -1.35 |
| TPSA | 252.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 875.38 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze dibismuth;N-phenylaniline;trisulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibismuth;N-phenylaniline;trisulfate?
The IUPAC name of dibismuth;N-phenylaniline;trisulfate (CID 174856272) is dibismuth;N-phenylaniline;trisulfate.
What is the SMILES notation for dibismuth;N-phenylaniline;trisulfate?
The canonical SMILES for dibismuth;N-phenylaniline;trisulfate is O=S(=O)([O-])[O-].O=S(=O)([O-])[O-].O=S(=O)([O-])[O-].[Bi+3].[Bi+3].c1ccc(Nc2ccccc2)cc1.
What is the InChIKey of dibismuth;N-phenylaniline;trisulfate?
The InChIKey is NMDILZOGCFABKO-UHFFFAOYSA-H. The full InChI is InChI=1S/C12H11N.2Bi.3H2O4S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;;3*1-5(2,3)4/h1-10,13H;;;3*(H2,1,2,3,4)/q;2*+3;;;/p-6.
What are the key properties of dibismuth;N-phenylaniline;trisulfate?
dibismuth;N-phenylaniline;trisulfate has a molecular weight of 875.38 g/mol, XLogP of -1.35, 2 rotatable bonds, 1 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for dibismuth;N-phenylaniline;trisulfate is sourced from PubChem (CID 174856272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).