About diamino sulfate;N-phenylaniline
diamino sulfate;N-phenylaniline (PubChem CID 21071865) has the molecular formula C12H15N3O4S
and a molecular weight of 297.34 g/mol. Its IUPAC name is diamino sulfate;N-phenylaniline.
Molecular Properties
| Compound Name | diamino sulfate;N-phenylaniline |
| PubChem CID | 21071865 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | diamino sulfate;N-phenylaniline |
| SMILES | NOS(=O)(=O)ON.c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11N.H4N2O4S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-5-7(3,4)6-2/h1-10,13H;1-2H2 |
| InChIKey | GAFSPHCTFZXBRN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze diamino sulfate;N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diamino sulfate;N-phenylaniline?
The IUPAC name of diamino sulfate;N-phenylaniline (CID 21071865) is diamino sulfate;N-phenylaniline.
What is the SMILES notation for diamino sulfate;N-phenylaniline?
The canonical SMILES for diamino sulfate;N-phenylaniline is NOS(=O)(=O)ON.c1ccc(Nc2ccccc2)cc1.
What is the InChIKey of diamino sulfate;N-phenylaniline?
The InChIKey is GAFSPHCTFZXBRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.H4N2O4S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-5-7(3,4)6-2/h1-10,13H;1-2H2.
What are the key properties of diamino sulfate;N-phenylaniline?
diamino sulfate;N-phenylaniline has a molecular weight of 297.34 g/mol, XLogP of 1.44, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diamino sulfate;N-phenylaniline is sourced from PubChem (CID 21071865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).