About N,N-diphenylnitrous amide
N,N-diphenylnitrous amide (PubChem CID 6838) has the molecular formula C12H10N2O
and a molecular weight of 198.22 g/mol. Its IUPAC name is N,N-diphenylnitrous amide.
Molecular Properties
| Compound Name | N,N-diphenylnitrous amide |
| PubChem CID | 6838 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | N,N-diphenylnitrous amide |
| SMILES | O=NN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H10N2O/c15-13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | UBUCNCOMADRQHX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-diphenylnitrous amide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diphenylnitrous amide?
The IUPAC name of N,N-diphenylnitrous amide (CID 6838) is N,N-diphenylnitrous amide.
What is the SMILES notation for N,N-diphenylnitrous amide?
The canonical SMILES for N,N-diphenylnitrous amide is O=NN(c1ccccc1)c1ccccc1.
What is the InChIKey of N,N-diphenylnitrous amide?
The InChIKey is UBUCNCOMADRQHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O/c15-13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H.
What are the key properties of N,N-diphenylnitrous amide?
N,N-diphenylnitrous amide has a molecular weight of 198.22 g/mol, XLogP of 3.51, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diphenylnitrous amide is sourced from PubChem (CID 6838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).