C32H28N4O4 — CID 21486208
N-[4-[[9,10-dioxo-4-[4-(propanoylamino)anilino]anthracen-1-yl]amino]phenyl]propanamide (PubChem CID 21486208) has the molecular formula C32H28N4O4 and a molecular weight of 532.60 g/mol. Its IUPAC name is N-[4-[[9,10-dioxo-4-[4-(propanoylamino)anilino]anthracen-1-yl]amino]phenyl]propanamide.
| Compound Name | N-[4-[[9,10-dioxo-4-[4-(propanoylamino)anilino]anthracen-1-yl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 21486208 |
| Molecular Formula | C32H28N4O4 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | N-[4-[[9,10-dioxo-4-[4-(propanoylamino)anilino]anthracen-1-yl]amino]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(Nc2ccc(Nc3ccc(NC(=O)CC)cc3)c3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C32H28N4O4/c1-3-27(37)35-21-13-9-19(10-14-21)33-25-17-18-26(34-20-11-15-22(16-12-20)36-28(38)4-2)30-29(25)31(39)23-7-5-6-8-24(23)32(30)40/h5-18,33-34H,3-4H2,1-2H3,(H,35,37)(H,36,38) |
| InChIKey | UMXFIHLBQXNFAM-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|