C26H24N2O3 — CID 59414687
N-[4-[(9,10-dioxoanthracen-1-yl)amino]phenyl]-2,2-dimethylbutanamide (PubChem CID 59414687) has the molecular formula C26H24N2O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-[4-[(9,10-dioxoanthracen-1-yl)amino]phenyl]-2,2-dimethylbutanamide.
| Compound Name | N-[4-[(9,10-dioxoanthracen-1-yl)amino]phenyl]-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 59414687 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | N-[4-[(9,10-dioxoanthracen-1-yl)amino]phenyl]-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)Nc1ccc(Nc2cccc3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C26H24N2O3/c1-4-26(2,3)25(31)28-17-14-12-16(13-15-17)27-21-11-7-10-20-22(21)24(30)19-9-6-5-8-18(19)23(20)29/h5-15,27H,4H2,1-3H3,(H,28,31) |
| InChIKey | HPSJFZOQSRLRMI-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|