C28H22N2O4 — CID 22756934
1,8-bis(4-methoxyanilino)anthracene-9,10-dione (PubChem CID 22756934) has the molecular formula C28H22N2O4 and a molecular weight of 450.49 g/mol. Its IUPAC name is 1,8-bis(4-methoxyanilino)anthracene-9,10-dione.
| Compound Name | 1,8-bis(4-methoxyanilino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 22756934 |
| Molecular Formula | C28H22N2O4 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 1,8-bis(4-methoxyanilino)anthracene-9,10-dione |
| SMILES | COc1ccc(Nc2cccc3c2C(=O)c2c(Nc4ccc(OC)cc4)cccc2C3=O)cc1 |
| InChI | InChI=1S/C28H22N2O4/c1-33-19-13-9-17(10-14-19)29-23-7-3-5-21-25(23)28(32)26-22(27(21)31)6-4-8-24(26)30-18-11-15-20(34-2)16-12-18/h3-16,29-30H,1-2H3 |
| InChIKey | DEECCMJSCCQTKM-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|