C29H24N2O6 — CID 139704349
1-(4-ethoxyanilino)-4,8-dihydroxy-5-(4-methoxyanilino)anthracene-9,10-dione (PubChem CID 139704349) has the molecular formula C29H24N2O6 and a molecular weight of 496.52 g/mol. Its IUPAC name is 1-(4-ethoxyanilino)-4,8-dihydroxy-5-(4-methoxyanilino)anthracene-9,10-dione.
| Compound Name | 1-(4-ethoxyanilino)-4,8-dihydroxy-5-(4-methoxyanilino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 139704349 |
| Molecular Formula | C29H24N2O6 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 1-(4-ethoxyanilino)-4,8-dihydroxy-5-(4-methoxyanilino)anthracene-9,10-dione |
| SMILES | CCOc1ccc(Nc2ccc(O)c3c2C(=O)c2c(O)ccc(Nc4ccc(OC)cc4)c2C3=O)cc1 |
| InChI | InChI=1S/C29H24N2O6/c1-3-37-19-10-6-17(7-11-19)31-21-13-15-23(33)27-25(21)29(35)26-22(32)14-12-20(24(26)28(27)34)30-16-4-8-18(36-2)9-5-16/h4-15,30-33H,3H2,1-2H3 |
| InChIKey | YBVUEAXDGNKRNU-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|