C24H27NO5 — CID 54217766
5,8-dihydroxy-2-(4-octoxyanilino)naphthalene-1,4-dione (PubChem CID 54217766) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is 5,8-dihydroxy-2-(4-octoxyanilino)naphthalene-1,4-dione.
| Compound Name | 5,8-dihydroxy-2-(4-octoxyanilino)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 54217766 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 5,8-dihydroxy-2-(4-octoxyanilino)naphthalene-1,4-dione |
| SMILES | CCCCCCCCOc1ccc(NC2=CC(=O)c3c(O)ccc(O)c3C2=O)cc1 |
| InChI | InChI=1S/C24H27NO5/c1-2-3-4-5-6-7-14-30-17-10-8-16(9-11-17)25-18-15-21(28)22-19(26)12-13-20(27)23(22)24(18)29/h8-13,15,25-27H,2-7,14H2,1H3 |
| InChIKey | QAKBMTXRROZZIA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|