C27H25N3O5 — CID 90935896
tert-butyl N-[2-acetamido-5-[(9,10-dioxoanthracen-1-yl)amino]phenyl]carbamate (PubChem CID 90935896) has the molecular formula C27H25N3O5 and a molecular weight of 471.51 g/mol. Its IUPAC name is tert-butyl N-[2-acetamido-5-[(9,10-dioxoanthracen-1-yl)amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-acetamido-5-[(9,10-dioxoanthracen-1-yl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 90935896 |
| Molecular Formula | C27H25N3O5 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | tert-butyl N-[2-acetamido-5-[(9,10-dioxoanthracen-1-yl)amino]phenyl]carbamate |
| SMILES | CC(=O)Nc1ccc(Nc2cccc3c2C(=O)c2ccccc2C3=O)cc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H25N3O5/c1-15(31)28-20-13-12-16(14-22(20)30-26(34)35-27(2,3)4)29-21-11-7-10-19-23(21)25(33)18-9-6-5-8-17(18)24(19)32/h5-14,29H,1-4H3,(H,28,31)(H,30,34) |
| InChIKey | LGRARERJFOTEGT-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|