C24H20N2O4 — CID 16833215
3-[[4-(4-methylanilino)-9,10-dioxoanthracen-1-yl]amino]propanoic acid (PubChem CID 16833215) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is 3-[[4-(4-methylanilino)-9,10-dioxoanthracen-1-yl]amino]propanoic acid.
| Compound Name | 3-[[4-(4-methylanilino)-9,10-dioxoanthracen-1-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 16833215 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 3-[[4-(4-methylanilino)-9,10-dioxoanthracen-1-yl]amino]propanoic acid |
| SMILES | Cc1ccc(Nc2ccc(NCCC(=O)O)c3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C24H20N2O4/c1-14-6-8-15(9-7-14)26-19-11-10-18(25-13-12-20(27)28)21-22(19)24(30)17-5-3-2-4-16(17)23(21)29/h2-11,25-26H,12-13H2,1H3,(H,27,28) |
| InChIKey | YFCHJKTUBRIHRC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|