C32H33NO4 — CID 101260007
[4-(4-methylanilino)-9,10-dioxoanthracen-1-yl] undec-10-enoate (PubChem CID 101260007) has the molecular formula C32H33NO4 and a molecular weight of 495.62 g/mol. Its IUPAC name is [4-(4-methylanilino)-9,10-dioxoanthracen-1-yl] undec-10-enoate.
| Compound Name | [4-(4-methylanilino)-9,10-dioxoanthracen-1-yl] undec-10-enoate |
|---|---|
| PubChem CID | 101260007 |
| Molecular Formula | C32H33NO4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | [4-(4-methylanilino)-9,10-dioxoanthracen-1-yl] undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)Oc1ccc(Nc2ccc(C)cc2)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C32H33NO4/c1-3-4-5-6-7-8-9-10-15-28(34)37-27-21-20-26(33-23-18-16-22(2)17-19-23)29-30(27)32(36)25-14-12-11-13-24(25)31(29)35/h3,11-14,16-21,33H,1,4-10,15H2,2H3 |
| InChIKey | WFKKIOMJOOWEKY-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|