About [4-(4-methylanilino)-9,10-dioxoanthracen-1-yl] undec-10-enoate
[4-(4-methylanilino)-9,10-dioxoanthracen-1-yl] undec-10-enoate (PubChem CID 101260007) has the molecular formula C32H33NO4
and a molecular weight of 495.62 g/mol. Its IUPAC name is [4-(4-methylanilino)-9,10-dioxoanthracen-1-yl] undec-10-enoate.
Molecular Properties
| Compound Name | [4-(4-methylanilino)-9,10-dioxoanthracen-1-yl] undec-10-enoate |
| PubChem CID | 101260007 |
| Molecular Formula | C32H33NO4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | [4-(4-methylanilino)-9,10-dioxoanthracen-1-yl] undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)Oc1ccc(Nc2ccc(C)cc2)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C32H33NO4/c1-3-4-5-6-7-8-9-10-15-28(34)37-27-21-20-26(33-23-18-16-22(2)17-19-23)29-30(27)32(36)25-14-12-11-13-24(25)31(29)35/h3,11-14,16-21,33H,1,4-10,15H2,2H3 |
| InChIKey | WFKKIOMJOOWEKY-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-methylanilino)-9,10-dioxoanthracen-1-yl] undec-10-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-methylanilino)-9,10-dioxoanthracen-1-yl] undec-10-enoate?
The IUPAC name of [4-(4-methylanilino)-9,10-dioxoanthracen-1-yl] undec-10-enoate (CID 101260007) is [4-(4-methylanilino)-9,10-dioxoanthracen-1-yl] undec-10-enoate.
What is the SMILES notation for [4-(4-methylanilino)-9,10-dioxoanthracen-1-yl] undec-10-enoate?
The canonical SMILES for [4-(4-methylanilino)-9,10-dioxoanthracen-1-yl] undec-10-enoate is C=CCCCCCCCCC(=O)Oc1ccc(Nc2ccc(C)cc2)c2c1C(=O)c1ccccc1C2=O.
What is the InChIKey of [4-(4-methylanilino)-9,10-dioxoanthracen-1-yl] undec-10-enoate?
The InChIKey is WFKKIOMJOOWEKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H33NO4/c1-3-4-5-6-7-8-9-10-15-28(34)37-27-21-20-26(33-23-18-16-22(2)17-19-23)29-30(27)32(36)25-14-12-11-13-24(25)31(29)35/h3,11-14,16-21,33H,1,4-10,15H2,2H3.
What are the key properties of [4-(4-methylanilino)-9,10-dioxoanthracen-1-yl] undec-10-enoate?
[4-(4-methylanilino)-9,10-dioxoanthracen-1-yl] undec-10-enoate has a molecular weight of 495.62 g/mol, XLogP of 7.73, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-methylanilino)-9,10-dioxoanthracen-1-yl] undec-10-enoate is sourced from PubChem (CID 101260007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).