C19H18N2O4 — CID 151602596
[4-[1-(methylamino)ethylamino]-9,10-dioxoanthracen-1-yl] acetate (PubChem CID 151602596) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is [4-[1-(methylamino)ethylamino]-9,10-dioxoanthracen-1-yl] acetate.
| Compound Name | [4-[1-(methylamino)ethylamino]-9,10-dioxoanthracen-1-yl] acetate |
|---|---|
| PubChem CID | 151602596 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | [4-[1-(methylamino)ethylamino]-9,10-dioxoanthracen-1-yl] acetate |
| SMILES | CNC(C)Nc1ccc(OC(C)=O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H18N2O4/c1-10(20-3)21-14-8-9-15(25-11(2)22)17-16(14)18(23)12-6-4-5-7-13(12)19(17)24/h4-10,20-21H,1-3H3 |
| InChIKey | QKUOCAMTIHKIDI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|