C20H24N4O4 — CID 88725997
1,4-dihydroxy-5,8-bis[1-(methylamino)ethylamino]anthracene-9,10-dione (PubChem CID 88725997) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 1,4-dihydroxy-5,8-bis[1-(methylamino)ethylamino]anthracene-9,10-dione.
| Compound Name | 1,4-dihydroxy-5,8-bis[1-(methylamino)ethylamino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 88725997 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 1,4-dihydroxy-5,8-bis[1-(methylamino)ethylamino]anthracene-9,10-dione |
| SMILES | CNC(C)Nc1ccc(NC(C)NC)c2c1C(=O)c1c(O)ccc(O)c1C2=O |
| InChI | InChI=1S/C20H24N4O4/c1-9(21-3)23-11-5-6-12(24-10(2)22-4)16-15(11)19(27)17-13(25)7-8-14(26)18(17)20(16)28/h5-10,21-26H,1-4H3 |
| InChIKey | MKTGXMKCUUNADQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|