C25H34N4O5S — CID 139659363
1-hydroxy-5,8-bis[2-(2-hydroxyethylamino)ethylamino]-4-(1-methylsulfanylethyl)anthracene-9,10-dione (PubChem CID 139659363) has the molecular formula C25H34N4O5S and a molecular weight of 502.64 g/mol. Its IUPAC name is 1-hydroxy-5,8-bis[2-(2-hydroxyethylamino)ethylamino]-4-(1-methylsulfanylethyl)anthracene-9,10-dione.
| Compound Name | 1-hydroxy-5,8-bis[2-(2-hydroxyethylamino)ethylamino]-4-(1-methylsulfanylethyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 139659363 |
| Molecular Formula | C25H34N4O5S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 1-hydroxy-5,8-bis[2-(2-hydroxyethylamino)ethylamino]-4-(1-methylsulfanylethyl)anthracene-9,10-dione |
| SMILES | CSC(C)c1ccc(O)c2c1C(=O)c1c(NCCNCCO)ccc(NCCNCCO)c1C2=O |
| InChI | InChI=1S/C25H34N4O5S/c1-15(35-2)16-3-6-19(32)23-20(16)24(33)21-17(28-9-7-26-11-13-30)4-5-18(22(21)25(23)34)29-10-8-27-12-14-31/h3-6,15,26-32H,7-14H2,1-2H3 |
| InChIKey | GUBHTURMNYRLQO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 142.95 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|