C28H40Br2N4O10 — CID 174856644
1,6-dibromohexane-2,3,4,5-tetrol;1,4-dihydroxy-5,8-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione (PubChem CID 174856644) has the molecular formula C28H40Br2N4O10 and a molecular weight of 752.45 g/mol. Its IUPAC name is 1,6-dibromohexane-2,3,4,5-tetrol;1,4-dihydroxy-5,8-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione.
| Compound Name | 1,6-dibromohexane-2,3,4,5-tetrol;1,4-dihydroxy-5,8-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 174856644 |
| Molecular Formula | C28H40Br2N4O10 |
| Molecular Weight | 752.45 g/mol |
| Exact Mass | 750.11 |
| IUPAC Name | 1,6-dibromohexane-2,3,4,5-tetrol;1,4-dihydroxy-5,8-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione |
| SMILES | O=C1c2c(O)ccc(O)c2C(=O)c2c(NCCNCCO)ccc(NCCNCCO)c21.OC(CBr)C(O)C(O)C(O)CBr |
| InChI | InChI=1S/C22H28N4O6.C6H12Br2O4/c27-11-9-23-5-7-25-13-1-2-14(26-8-6-24-10-12-28)18-17(13)21(31)19-15(29)3-4-16(30)20(19)22(18)32;7-1-3(9)5(11)6(12)4(10)2-8/h1-4,23-30H,5-12H2;3-6,9-12H,1-2H2 |
| InChIKey | DVTDOLHRIYKYTD-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 244.10 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.45 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|