C31H36N4O10 — CID 69294475
1,4-dihydroxy-5,8-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione;(E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid (PubChem CID 69294475) has the molecular formula C31H36N4O10 and a molecular weight of 624.65 g/mol. Its IUPAC name is 1,4-dihydroxy-5,8-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione;(E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid.
| Compound Name | 1,4-dihydroxy-5,8-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione;(E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 69294475 |
| Molecular Formula | C31H36N4O10 |
| Molecular Weight | 624.65 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | 1,4-dihydroxy-5,8-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione;(E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(O)c(O)c1.O=C1c2c(O)ccc(O)c2C(=O)c2c(NCCNCCO)ccc(NCCNCCO)c21 |
| InChI | InChI=1S/C22H28N4O6.C9H8O4/c27-11-9-23-5-7-25-13-1-2-14(26-8-6-24-10-12-28)18-17(13)21(31)19-15(29)3-4-16(30)20(19)22(18)32;10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-4,23-30H,5-12H2;1-5,10-11H,(H,12,13)/b;4-2+ |
| InChIKey | KINGPEAJKDATDV-QGLCECKVSA-N |
| XLogP | 1.06 |
| TPSA | 240.94 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.65 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|