C23H30N4O6 — CID 143270488
1,4-dihydroxy-5-[2-(2-hydroxyethylamino)ethylamino]-8-[3-(2-hydroxyethylamino)propylamino]anthracene-9,10-dione (PubChem CID 143270488) has the molecular formula C23H30N4O6 and a molecular weight of 458.52 g/mol. Its IUPAC name is 1,4-dihydroxy-5-[2-(2-hydroxyethylamino)ethylamino]-8-[3-(2-hydroxyethylamino)propylamino]anthracene-9,10-dione.
| Compound Name | 1,4-dihydroxy-5-[2-(2-hydroxyethylamino)ethylamino]-8-[3-(2-hydroxyethylamino)propylamino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 143270488 |
| Molecular Formula | C23H30N4O6 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 1,4-dihydroxy-5-[2-(2-hydroxyethylamino)ethylamino]-8-[3-(2-hydroxyethylamino)propylamino]anthracene-9,10-dione |
| SMILES | O=C1c2c(O)ccc(O)c2C(=O)c2c(NCCNCCO)ccc(NCCCNCCO)c21 |
| InChI | InChI=1S/C23H30N4O6/c28-12-10-24-6-1-7-26-14-2-3-15(27-9-8-25-11-13-29)19-18(14)22(32)20-16(30)4-5-17(31)21(20)23(19)33/h2-5,24-31H,1,6-13H2 |
| InChIKey | UVVNLPYSZDSAIX-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 163.18 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|