C24H32N4O4 — CID 122197323
1,4-bis[2-(dimethylamino)propylamino]-5,8-dihydroxyanthracene-9,10-dione (PubChem CID 122197323) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is 1,4-bis[2-(dimethylamino)propylamino]-5,8-dihydroxyanthracene-9,10-dione.
| Compound Name | 1,4-bis[2-(dimethylamino)propylamino]-5,8-dihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 122197323 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 1,4-bis[2-(dimethylamino)propylamino]-5,8-dihydroxyanthracene-9,10-dione |
| SMILES | CC(CNc1ccc(NCC(C)N(C)C)c2c1C(=O)c1c(O)ccc(O)c1C2=O)N(C)C |
| InChI | InChI=1S/C24H32N4O4/c1-13(27(3)4)11-25-15-7-8-16(26-12-14(2)28(5)6)20-19(15)23(31)21-17(29)9-10-18(30)22(21)24(20)32/h7-10,13-14,25-26,29-30H,11-12H2,1-6H3 |
| InChIKey | XFVGKHFBPDRDCH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|