C16H11N3O4 — CID 58070739
2-[(5-amino-4,8-dihydroxy-9,10-dioxoanthracen-1-yl)amino]acetonitrile (PubChem CID 58070739) has the molecular formula C16H11N3O4 and a molecular weight of 309.28 g/mol. Its IUPAC name is 2-[(5-amino-4,8-dihydroxy-9,10-dioxoanthracen-1-yl)amino]acetonitrile.
| Compound Name | 2-[(5-amino-4,8-dihydroxy-9,10-dioxoanthracen-1-yl)amino]acetonitrile |
|---|---|
| PubChem CID | 58070739 |
| Molecular Formula | C16H11N3O4 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-[(5-amino-4,8-dihydroxy-9,10-dioxoanthracen-1-yl)amino]acetonitrile |
| SMILES | N#CCNc1ccc(O)c2c1C(=O)c1c(O)ccc(N)c1C2=O |
| InChI | InChI=1S/C16H11N3O4/c17-5-6-19-8-2-4-10(21)14-12(8)16(23)13-9(20)3-1-7(18)11(13)15(14)22/h1-4,19-21H,6,18H2 |
| InChIKey | CMNREOWUMPOEFP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 136.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|