C14H10N2O4 — CID 146311239
1,8-diamino-2,5-dihydroxyanthracene-9,10-dione (PubChem CID 146311239) has the molecular formula C14H10N2O4 and a molecular weight of 270.24 g/mol. Its IUPAC name is 1,8-diamino-2,5-dihydroxyanthracene-9,10-dione.
| Compound Name | 1,8-diamino-2,5-dihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 146311239 |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 1,8-diamino-2,5-dihydroxyanthracene-9,10-dione |
| SMILES | Nc1ccc(O)c2c1C(=O)c1c(ccc(O)c1N)C2=O |
| InChI | InChI=1S/C14H10N2O4/c15-6-2-4-7(17)11-10(6)14(20)9-5(13(11)19)1-3-8(18)12(9)16/h1-4,17-18H,15-16H2 |
| InChIKey | NXJYIDDMNNFUQP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|