C15H10N2O6 — CID 158490157
4,5-diamino-3,8-dihydroxy-9,10-dioxoanthracene-2-carboxylic acid (PubChem CID 158490157) has the molecular formula C15H10N2O6 and a molecular weight of 314.25 g/mol. Its IUPAC name is 4,5-diamino-3,8-dihydroxy-9,10-dioxoanthracene-2-carboxylic acid.
| Compound Name | 4,5-diamino-3,8-dihydroxy-9,10-dioxoanthracene-2-carboxylic acid |
|---|---|
| PubChem CID | 158490157 |
| Molecular Formula | C15H10N2O6 |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 4,5-diamino-3,8-dihydroxy-9,10-dioxoanthracene-2-carboxylic acid |
| SMILES | Nc1ccc(O)c2c1C(=O)c1c(cc(C(=O)O)c(O)c1N)C2=O |
| InChI | InChI=1S/C15H10N2O6/c16-6-1-2-7(18)10-9(6)14(21)8-4(12(10)19)3-5(15(22)23)13(20)11(8)17/h1-3,18,20H,16-17H2,(H,22,23) |
| InChIKey | HIPFUGBUYWTMDD-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 163.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|