C26H17NO3S — CID 18970540
1-amino-8-hydroxy-2,3-diphenyl-5-sulfanylanthracene-9,10-dione (PubChem CID 18970540) has the molecular formula C26H17NO3S and a molecular weight of 423.49 g/mol. Its IUPAC name is 1-amino-8-hydroxy-2,3-diphenyl-5-sulfanylanthracene-9,10-dione.
| Compound Name | 1-amino-8-hydroxy-2,3-diphenyl-5-sulfanylanthracene-9,10-dione |
|---|---|
| PubChem CID | 18970540 |
| Molecular Formula | C26H17NO3S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 1-amino-8-hydroxy-2,3-diphenyl-5-sulfanylanthracene-9,10-dione |
| SMILES | Nc1c2c(cc(-c3ccccc3)c1-c1ccccc1)C(=O)c1c(S)ccc(O)c1C2=O |
| InChI | InChI=1S/C26H17NO3S/c27-24-20(15-9-5-2-6-10-15)16(14-7-3-1-4-8-14)13-17-21(24)26(30)22-18(28)11-12-19(31)23(22)25(17)29/h1-13,28,31H,27H2 |
| InChIKey | IDMIYRZKLHAUJS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|