C18H14N2O5 — CID 57156423
(4,8-diamino-5-hydroxy-9,10-dioxoanthracen-1-yl) 2-methylprop-2-enoate (PubChem CID 57156423) has the molecular formula C18H14N2O5 and a molecular weight of 338.32 g/mol. Its IUPAC name is (4,8-diamino-5-hydroxy-9,10-dioxoanthracen-1-yl) 2-methylprop-2-enoate.
| Compound Name | (4,8-diamino-5-hydroxy-9,10-dioxoanthracen-1-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 57156423 |
| Molecular Formula | C18H14N2O5 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (4,8-diamino-5-hydroxy-9,10-dioxoanthracen-1-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(N)c2c1C(=O)c1c(N)ccc(O)c1C2=O |
| InChI | InChI=1S/C18H14N2O5/c1-7(2)18(24)25-11-6-4-9(20)13-15(11)17(23)12-8(19)3-5-10(21)14(12)16(13)22/h3-6,21H,1,19-20H2,2H3 |
| InChIKey | CKNQFQXGIDLTJU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 132.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|